|
CAS#: 1209-83-2 Product: 4,5-Dimethyl-9,10-Dihydrophenanthrene No suppilers available for the product. |
| Name | 4,5-Dimethyl-9,10-Dihydrophenanthrene |
|---|---|
| Synonyms | Nsc127196; Phenanthrene, 9,10-Dihydro-4,5-Dimethyl-; 4,5-Dimethyl-[9,10-Dihydrophenanthrene] |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 1209-83-2 |
| SMILES | C1=C(C)C2=C(C=C1)CCC3=CC=CC(=C23)C |
| InChI | 1S/C16H16/c1-11-5-3-7-13-9-10-14-8-4-6-12(2)16(14)15(11)13/h3-8H,9-10H2,1-2H3 |
| InChIKey | PQQHEWUCMWFIJP-UHFFFAOYSA-N |
| Density | 1.049g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.562°C at 760 mmHg (Cal.) |
| Flash point | 169.448°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dimethyl-9,10-Dihydrophenanthrene |