| Name | (1S)-N,N-Dimethyl-1-(1-Naphthyl)Ethanamine |
|---|---|
| Synonyms | (S)-(-)-N,N-Dimethyl-1-(1-naphthyl)ethylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.29 |
| CAS Registry Number | 121045-73-6 |
| SMILES | c1cccc2cccc(c12)[C@@H](N(C)C)C |
| InChI | 1S/C14H17N/c1-11(15(2)3)13-10-6-8-12-7-4-5-9-14(12)13/h4-11H,1-3H3/t11-/m0/s1 |
| InChIKey | AXRXYILTIWBHEP-NSHDSACASA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.192°C at 760 mmHg (Cal.) |
| Flash point | 114.29°C (Cal.) |
| Refractive index | 1.59 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Mengtao Ma, Ruifeng Lu, Sumod A. Pullarkat, Weiqiao Deng and Pak-Hing Leung. Steric effects on the control of endo/exo-selectivity in the asymmetric cycloaddition reaction of 3,4-dimethyl-1-phenylarsole, Dalton Trans., 2010, 39, 5453. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1S)-N,N-Dimethyl-1-(1-Naphthyl)Ethanamine |