|
CAS#: 121104-76-5 Product: [(1S,6S,7S,8R,8aR)-1,7,8-Trihydroxy-1,2,3,5,6,7,8,8a-Octahydroindolizin-6-Yl] Benzoate No suppilers available for the product. |
| Name | [(1S,6S,7S,8R,8aR)-1,7,8-Trihydroxy-1,2,3,5,6,7,8,8a-Octahydroindolizin-6-Yl] Benzoate |
|---|---|
| Synonyms | Benzoic Acid [(1S,6S,7S,8R,8Ar)-1,7,8-Trihydroxy-1,2,3,5,6,7,8,8A-Octahydroindolizin-6-Yl] Ester; Benzoic Acid [(1S,6S,7S,8R,8Ar)-1,7,8-Trihydroxyindolizidin-6-Yl] Ester; Aids-000246 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 |
| CAS Registry Number | 121104-76-5 |
| SMILES | [C@H]23N(C[C@H](OC(C1=CC=CC=C1)=O)[C@H]([C@@H]2O)O)CC[C@@H]3O |
| InChI | 1S/C15H19NO5/c17-10-6-7-16-8-11(13(18)14(19)12(10)16)21-15(20)9-4-2-1-3-5-9/h1-5,10-14,17-19H,6-8H2/t10-,11-,12+,13+,14+/m0/s1 |
| InChIKey | DWBDMLGCCJIACZ-ODXJTPSBSA-N |
| Density | 1.429g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.973°C at 760 mmHg (Cal.) |
| Flash point | 252.546°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(1S,6S,7S,8R,8aR)-1,7,8-Trihydroxy-1,2,3,5,6,7,8,8a-Octahydroindolizin-6-Yl] Benzoate |