| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 5-Benzylidene-2,2-Dimethyl-1,3-Dioxane-4,6-Dione |
|---|---|
| Synonyms | 2,2-dimethyl-5-(phenylmethylene)-1,3-dioxane-4,6-dione; 2,2-Dimethyl-5-benzyliden-1,3-dioxan-4,6-dion |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 |
| CAS Registry Number | 1214-54-6 |
| SMILES | CC1(OC(=O)C(=CC2=CC=CC=C2)C(=O)O1)C |
| InChI | 1S/C13H12O4/c1-13(2)16-11(14)10(12(15)17-13)8-9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | GMOOBZIVAQBVQK-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 168-170°C (Expl.) |
| Boiling point | 472.5±45.0°C at 760 mmHg (Cal.) |
| Flash point | 251.9±27.1°C (Cal.) |
| Refractive index | 1.573 (Cal.) |
| (1) | Streuff et al.. A palladium-catalysed enolate alkylation cascade for the formation of adjacent quaternary and tertiary stereocentres, Nature Chemistry, 2010 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Benzylidene-2,2-Dimethyl-1,3-Dioxane-4,6-Dione |