|
CAS#: 121559-53-3 Product: 2-Methoxyethyl 2,2,2-Trifluoroethanesulfonate No suppilers available for the product. |
| Name | 2-Methoxyethyl 2,2,2-Trifluoroethanesulfonate |
|---|---|
| Synonyms | 2,2,2-Trifluoroethanesulfonic Acid 2-Methoxyethyl Ester; 2,2,2-Trifluoroethane Sulfonyl-Monomethoxypolyethylene Glycol; Poly(Oxy-1,2-Ethanediyl), Alpha-((2,2,2-Trifluoroethyl)Sulfonyl)-Omega-Methoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C5H9F3O4S |
| Molecular Weight | 222.18 |
| CAS Registry Number | 121559-53-3 |
| SMILES | C(C(F)(F)F)[S](OCCOC)(=O)=O |
| InChI | 1S/C5H9F3O4S/c1-11-2-3-12-13(9,10)4-5(6,7)8/h2-4H2,1H3 |
| InChIKey | DISXNVGIQYXZRE-UHFFFAOYSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 253.362°C at 760 mmHg (Cal.) |
| Flash point | 107.03°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxyethyl 2,2,2-Trifluoroethanesulfonate |