|
CAS#: 121588-75-8 Product: N-Cyclohexyl-1-isopropyl-6-methylergoline-8beta-carboxamide No suppilers available for the product. |
| Name | N-Cyclohexyl-1-isopropyl-6-methylergoline-8beta-carboxamide |
|---|---|
| Synonyms | Pdsp1_000759; Amesergide; Amesergide [Usan:Inn] |
| Molecular Structure | ![]() |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.57 |
| CAS Registry Number | 121588-75-8 |
| SMILES | [C@H]4(CC3C2=C1C(=C[N](C1=CC=C2)C(C)C)CC3N(C4)C)C(NC5CCCCC5)=O |
| InChI | 1S/C25H35N3O/c1-16(2)28-15-17-13-23-21(20-10-7-11-22(28)24(17)20)12-18(14-27(23)3)25(29)26-19-8-5-4-6-9-19/h7,10-11,15-16,18-19,21,23H,4-6,8-9,12-14H2,1-3H3,(H,26,29)/t18-,21?,23?/m1/s1 |
| InChIKey | KEMOOQHMCGCZKH-FBHNJWQJSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 611.57°C at 760 mmHg (Cal.) |
| Flash point | 323.666°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Cyclohexyl-1-isopropyl-6-methylergoline-8beta-carboxamide |