|
CAS#: 121593-87-1 Product: 6-Chloro-1-(3-Chloro-4-Methoxybenzyl)-3-Methyl-2,4(1H,3H)-Pyrimidinedione No suppilers available for the product. |
| Name | 6-Chloro-1-(3-Chloro-4-Methoxybenzyl)-3-Methyl-2,4(1H,3H)-Pyrimidinedione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H12Cl2N2O3 |
| Molecular Weight | 315.15 |
| CAS Registry Number | 121593-87-1 |
| SMILES | Cn1c(=O)cc(n(c1=O)Cc2ccc(c(c2)Cl)OC)Cl |
| InChI | 1S/C13H12Cl2N2O3/c1-16-12(18)6-11(15)17(13(16)19)7-8-3-4-10(20-2)9(14)5-8/h3-6H,7H2,1-2H3 |
| InChIKey | ZATKIOGERXWFBW-UHFFFAOYSA-N |
| Density | 1.467g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.936°C at 760 mmHg (Cal.) |
| Flash point | 209.585°C (Cal.) |
| Refractive index | 1.628 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-1-(3-Chloro-4-Methoxybenzyl)-3-Methyl-2,4(1H,3H)-Pyrimidinedione |