|
CAS#: 121756-85-2 Product: 9-Nitro-(4)Peristylane-1,5-Dione No suppilers available for the product. |
| Name | 9-Nitro-(4)Peristylane-1,5-Dione |
|---|---|
| Synonyms | 9-Npldo |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 |
| CAS Registry Number | 121756-85-2 |
| SMILES | O=C3C5C1([N+]([O-])=O)C4C2C1C(C(=O)C2CC34)C5 |
| InChI | 1S/C12H11NO4/c14-10-3-1-4-8-7(3)9-5(10)2-6(11(4)15)12(8,9)13(16)17/h3-9H,1-2H2 |
| InChIKey | GSLDJVOBTKPRME-UHFFFAOYSA-N |
| Density | 1.62g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.554°C at 760 mmHg (Cal.) |
| Flash point | 237.46°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Nitro-(4)Peristylane-1,5-Dione |