|
CAS#: 1219-20-1 Product: Diethyl-[2-(3-Phenyl-1,2,4-Oxadiazol-5-Yl)Ethyl]Azanium Chloride No suppilers available for the product. |
| Name | Diethyl-[2-(3-Phenyl-1,2,4-Oxadiazol-5-Yl)Ethyl]Azanium Chloride |
|---|---|
| Synonyms | Diethyl-[2-(3-Phenyl-1,2,4-Oxadiazol-5-Yl)Ethyl]Ammonium Chloride; (Diethyl)(3-Phenyl-1,2,4-Oxadiazole-5-Ethyl)Ammonium Chloride; 1,2,4-Oxadiazole, 5-(2-(Diethylamino)Ethyl)-3-Phenyl-, Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.78 |
| CAS Registry Number | 1219-20-1 |
| EINECS | 214-940-6 |
| SMILES | C2=C(C1=NOC(=N1)CC[NH+](CC)CC)C=CC=C2.[Cl-] |
| InChI | 1S/C14H19N3O.ClH/c1-3-17(4-2)11-10-13-15-14(16-18-13)12-8-6-5-7-9-12;/h5-9H,3-4,10-11H2,1-2H3;1H |
| InChIKey | YHLIBHCNFDRYFW-UHFFFAOYSA-N |
| Boiling point | 364.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 174.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl-[2-(3-Phenyl-1,2,4-Oxadiazol-5-Yl)Ethyl]Azanium Chloride |