|
CAS#: 122001-14-3 Product: (2S)-2-Amino-3-(4-Fluoro-3-Hydroxyphenyl)Propanoic Acid No suppilers available for the product. |
| Name | (2S)-2-Amino-3-(4-Fluoro-3-Hydroxyphenyl)Propanoic Acid |
|---|---|
| Synonyms | (2S)-2-Amino-3-(4-Fluoro-3-Hydroxy-Phenyl)Propanoic Acid; (2S)-2-Amino-3-(4-Fluoro-3-Hydroxy-Phenyl)Propionic Acid; 4-Fluoro-3-Tyrosine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.18 |
| CAS Registry Number | 122001-14-3 |
| SMILES | [C@H](C(=O)O)(N)CC1=CC=C(C(=C1)O)F |
| InChI | 1S/C9H10FNO3/c10-6-2-1-5(4-8(6)12)3-7(11)9(13)14/h1-2,4,7,12H,3,11H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | MJDXVMZMAJGVLY-ZETCQYMHSA-N |
| Density | 1.422g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.155°C at 760 mmHg (Cal.) |
| Flash point | 179.478°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-Amino-3-(4-Fluoro-3-Hydroxyphenyl)Propanoic Acid |