|
CAS#: 122079-36-1 Product: Spiro(3H-2,1-benzoxathiole-3,7'-(7H)dibenzo(c,h)xanthene)-3',11'-diol, 1,1-dioxide No suppilers available for the product. |
| Name | Spiro(3H-2,1-benzoxathiole-3,7'-(7H)dibenzo(c,h)xanthene)-3',11'-diol, 1,1-dioxide |
|---|---|
| Synonyms | Vita Blue |
| Molecular Structure | ![]() |
| Molecular Formula | C27H16O6S |
| Molecular Weight | 468.48 |
| CAS Registry Number | 122079-36-1 |
| SMILES | C2=CC1=CC(=CC=C1C5=C2C3(O[S](=O)(=O)C4=CC=CC=C34)C7=C(O5)C6=CC=C(O)C=C6C=C7)O |
| InChI | 1S/C27H16O6S/c28-17-7-9-19-15(13-17)5-11-22-25(19)32-26-20-10-8-18(29)14-16(20)6-12-23(26)27(22)21-3-1-2-4-24(21)34(30,31)33-27/h1-14,28-29H |
| InChIKey | GNJZTWSDPQEIRS-UHFFFAOYSA-N |
| Density | 1.678g/cm3 (Cal.) |
|---|---|
| Boiling point | 756.237°C at 760 mmHg (Cal.) |
| Flash point | 411.158°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Spiro(3H-2,1-benzoxathiole-3,7'-(7H)dibenzo(c,h)xanthene)-3',11'-diol, 1,1-dioxide |