|
CAS#: 122168-70-1 Product: 1-Methyl-5-(4-Methylaminophenylazo)Indazole No suppilers available for the product. |
| Name | 1-Methyl-5-(4-Methylaminophenylazo)Indazole |
|---|---|
| Synonyms | N-Methyl-4-(1-Methylindazol-5-Yl)Azo-Aniline; N-Methyl-4-[(1-Methyl-5-Indazolyl)Azo]Aniline; Methyl-[4-(1-Methylindazol-5-Yl)Azophenyl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 |
| CAS Registry Number | 122168-70-1 |
| SMILES | C1=CC(=CC=C1NC)N=NC3=CC2=C([N](N=C2)C)C=C3 |
| InChI | 1S/C15H15N5/c1-16-12-3-5-13(6-4-12)18-19-14-7-8-15-11(9-14)10-17-20(15)2/h3-10,16H,1-2H3 |
| InChIKey | CEWVGHSHRLURPP-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.292°C at 760 mmHg (Cal.) |
| Flash point | 239.434°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-5-(4-Methylaminophenylazo)Indazole |