|
CAS#: 1224-64-2 Product: 1-Dibutylphosphoryloxy-4-Nitrobenzene No suppilers available for the product. |
| Name | 1-Dibutylphosphoryloxy-4-Nitrobenzene |
|---|---|
| Synonyms | 1-Dibutylphosphoryloxy-4-Nitro-Benzene; 4-06-00-01318 (Beilstein Handbook Reference); Brn 2509364 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22NO4P |
| Molecular Weight | 299.31 |
| CAS Registry Number | 1224-64-2 |
| SMILES | C1=C(O[P](CCCC)(CCCC)=O)C=CC(=C1)[N+](=O)[O-] |
| InChI | 1S/C14H22NO4P/c1-3-5-11-20(18,12-6-4-2)19-14-9-7-13(8-10-14)15(16)17/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | MQOMKCIKNDDXEZ-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.592°C at 760 mmHg (Cal.) |
| Flash point | 199.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Dibutylphosphoryloxy-4-Nitrobenzene |