|
CAS#: 122431-24-7 Product: Diethoxy-[1-Phenyl-3-(Trifluoromethyl)Pyrazol-4-Yl]Oxy-Thioxo-lambda5-Phosphane No suppilers available for the product. |
| Name | Diethoxy-[1-Phenyl-3-(Trifluoromethyl)Pyrazol-4-Yl]Oxy-Thioxo-lambda5-Phosphane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H16F3N2O3PS |
| Molecular Weight | 380.32 |
| CAS Registry Number | 122431-24-7 |
| SMILES | CCOP(=S)(OCC)Oc1cn(nc1C(F)(F)F)c2ccccc2 |
| InChI | 1S/C14H16F3N2O3PS/c1-3-20-23(24,21-4-2)22-12-10-19(11-8-6-5-7-9-11)18-13(12)14(15,16)17/h5-10H,3-4H2,1-2H3 |
| InChIKey | WDTRDDXOSGHRKV-UHFFFAOYSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.9°C at 760 mmHg (Cal.) |
| Flash point | 198.1°C (Cal.) |
| Refractive index | 1.54 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethoxy-[1-Phenyl-3-(Trifluoromethyl)Pyrazol-4-Yl]Oxy-Thioxo-lambda5-Phosphane |