|
CAS#: 1225-58-7 Product: 16beta-Estradiol No suppilers available for the product. |
| Name | 16beta-Estradiol |
|---|---|
| Synonyms | 16Beta-Estradiol; C15261; Estra-1,3,5(10)-Triene-3,16Beta-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 |
| CAS Registry Number | 1225-58-7 |
| SMILES | [C@]13(C[C@H](C[C@H]1[C@@H]2CCC4=C([C@H]2CC3)C=CC(=C4)O)O)C |
| InChI | 1S/C18H24O2/c1-18-7-6-15-14-5-3-12(19)8-11(14)2-4-16(15)17(18)9-13(20)10-18/h3,5,8,13,15-17,19-20H,2,4,6-7,9-10H2,1H3/t13-,15+,16+,17-,18+/m0/s1 |
| InChIKey | DVMAUGGKVWJBDV-IREHDKGXSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.917°C at 760 mmHg (Cal.) |
| Flash point | 209.634°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16beta-Estradiol |