Online Database of Chemicals from Around the World
| Name | 1-(3,4-Dichloro-5-Nitrofuran-2-Yl)Ethanone |
|---|---|
| Synonyms | 1-(3,4-Dichloro-5-Nitro-2-Furyl)Ethanone; 1-(3,4-Dichloro-5-Nitro-Furan-2-Yl)Ethanone; 1-(3,4-Dichloro-5-Nitro-2-Furanyl)Ethanone |
| Molecular Structure |  |
| Molecular Formula | C6H3Cl2NO4 |
| Molecular Weight | 224.00 |
| CAS Registry Number | 122587-20-6 |
| SMILES | CC(=O)C1=C(Cl)C(=C(O1)[N+]([O-])=O)Cl |
| InChI | 1S/C6H3Cl2NO4/c1-2(10)5-3(7)4(8)6(13-5)9(11)12/h1H3 |
| InChIKey | XFXWVERCUJGBEA-UHFFFAOYSA-N |
| Density | 1.606g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.564°C at 760 mmHg (Cal.) |
| Flash point | 108.966°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,4-Dichloro-5-Nitrofuran-2-Yl)Ethanone |
