|
CAS#: 122629-20-3 Product: Octahydro-2-Methyl-trans-5(1H)-Isoquinolone Methiodide No suppilers available for the product. |
| Name | Octahydro-2-Methyl-trans-5(1H)-Isoquinolone Methiodide |
|---|---|
| Synonyms | Octahydro-2-Methyl-Trans-5(1H)-Isoquinolone Methiodide; Omt-Isoquinolone Methiodide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H20INO |
| Molecular Weight | 309.19 |
| CAS Registry Number | 122629-20-3 |
| SMILES | [C@H]12[C@@H](CN(CC1)C)CCCC2=O.CI |
| InChI | 1S/C10H17NO.CH3I/c1-11-6-5-9-8(7-11)3-2-4-10(9)12;1-2/h8-9H,2-7H2,1H3;1H3/t8-,9-;/m1./s1 |
| InChIKey | GRLWEFQPKDRHFC-VTLYIQCISA-N |
| Boiling point | 253.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 99.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octahydro-2-Methyl-trans-5(1H)-Isoquinolone Methiodide |