|
CAS#: 12275-13-7 Product: Ethylenebis(Dithiocarbamic Acid)Nickel(II) Salt No suppilers available for the product. |
| Name | Ethylenebis(Dithiocarbamic Acid)Nickel(II) Salt |
|---|---|
| Synonyms | Nickelous [2-(Sulfidocarbothioylamino)Ethylamino]Methanedithioate; Nickelous [2-[(Sulfido-Thioxomethyl)Amino]Ethylamino]Methanedithioate; Ai3-61800 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H6N2NiS4 |
| Molecular Weight | 269.04 |
| CAS Registry Number | 12275-13-7 |
| SMILES | C(NC([S-])=S)CNC([S-])=S.[Ni++] |
| InChI | 1S/C4H8N2S4.Ni/c7-3(8)5-1-2-6-4(9)10;/h1-2H2,(H2,5,7,8)(H2,6,9,10);/q;+2/p-2 |
| InChIKey | LAHRFHINHFIDLM-UHFFFAOYSA-L |
| Boiling point | 308.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 140.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethylenebis(Dithiocarbamic Acid)Nickel(II) Salt |