|
CAS#: 122898-63-9 Product: Phenazinomycin No suppilers available for the product. |
| Name | Phenazinomycin |
|---|---|
| Synonyms | 5-[(E)-5-[(1S)-2,2-Dimethyl-6-Methylidenecyclohexyl]-3-Methylpent-2-Enyl]Phenazin-1-One; 5-[(E)-5-[(1S)-2,2-Dimethyl-6-Methylene-Cyclohexyl]-3-Methyl-Pent-2-Enyl]Phenazin-1-One; 5-[5-[(1S)-2,2-Dimethyl-6-Methylene-Cyclohexyl]-3-Methyl-Pent-2-Enyl]Phenazin-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.56 |
| CAS Registry Number | 122898-63-9 |
| SMILES | [C@@H]1(C(CCCC1=C)(C)C)CC/C(=C/CN3C2=CC=CC(=O)C2=NC4=C3C=CC=C4)C |
| InChI | 1S/C27H32N2O/c1-19(14-15-21-20(2)9-8-17-27(21,3)4)16-18-29-23-11-6-5-10-22(23)28-26-24(29)12-7-13-25(26)30/h5-7,10-13,16,21H,2,8-9,14-15,17-18H2,1,3-4H3/b19-16+/t21-/m1/s1 |
| InChIKey | APNRZHLOPQFNMR-WEIUTZTHSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 550.881°C at 760 mmHg (Cal.) |
| Flash point | 286.963°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenazinomycin |