|
CAS#: 122990-89-0 Product: 1-(2-Methyl-3-Methylene-7-Oxabicyclo[2.2.1]Hept-5-En-2-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(2-Methyl-3-Methylene-7-Oxabicyclo[2.2.1]Hept-5-En-2-Yl)Ethanone |
|---|---|
| Synonyms | 1-(2-meth |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 |
| CAS Registry Number | 122990-89-0 |
| SMILES | CC(=O)C1(C2C=CC(C1=C)O2)C |
| InChI | 1S/C10H12O2/c1-6-8-4-5-9(12-8)10(6,3)7(2)11/h4-5,8-9H,1H2,2-3H3 |
| InChIKey | WGQTWKLAMCBCCI-UHFFFAOYSA-N |
| Density | 1.095g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.698°C at 760 mmHg (Cal.) |
| Flash point | 102.122°C (Cal.) |
| Refractive index | 1.519 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Methyl-3-Methylene-7-Oxabicyclo[2.2.1]Hept-5-En-2-Yl)Ethanone |