|
CAS#: 123279-54-9 Product: 8(2),8(2)-Difluoroprotoporphyrin Dimethyl Ester No suppilers available for the product. |
| Name | 8(2),8(2)-Difluoroprotoporphyrin Dimethyl Ester |
|---|---|
| Synonyms | 8-Fppd; Dimethyl 7-(2,2-Difluoroethenyl)-12-Ethenyl-3,8,13,17-Tetramethyl-21H,23H-Porphine-2,18-Dipropanoate; 21H,23H-Porphine-2,18-Dipropanoic Acid, 7-(2,2-Difluoroethenyl)-12-Ethenyl-3,8,13,17-Tetramethyl-, Dimethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C36H36F2N4O4 |
| Molecular Weight | 626.70 |
| CAS Registry Number | 123279-54-9 |
| SMILES | C(C2=C(C3=CC1=C(C(=C([NH]1)C=C5[NH]C(=CC4=NC(=CC2=N3)C(=C4C)CCC(OC)=O)C(=C5C)C=C(F)F)C=C)C)C)CC(OC)=O |
| InChI | 1S/C36H36F2N4O4/c1-8-22-18(2)26-14-27-19(3)23(9-11-35(43)45-6)31(40-27)17-32-24(10-12-36(44)46-7)20(4)28(41-32)16-33-25(13-34(37)38)21(5)29(42-33)15-30(22)39-26/h8,13-17,39,42H,1,9-12H2,2-7H3 |
| InChIKey | ANDZQVARVBVOBG-UHFFFAOYSA-N |
| Density | 1.246g/cm3 (Cal.) |
|---|---|
| Boiling point | 1018.108°C at 760 mmHg (Cal.) |
| Flash point | 569.531°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8(2),8(2)-Difluoroprotoporphyrin Dimethyl Ester |