|
CAS#: 123356-12-7 Product: Methyl (2S,4S)-4-Hydroxy-5-Oxotetrahydro-2-Furancarboxylate No suppilers available for the product. |
| Name | Methyl (2S,4S)-4-Hydroxy-5-Oxotetrahydro-2-Furancarboxylate |
|---|---|
| Synonyms | (2S,4S)-methyl 4-hydroxy-5-oxotetrahydrofuran-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8O5 |
| Molecular Weight | 160.12 |
| CAS Registry Number | 123356-12-7 |
| SMILES | COC(=O)[C@@H]1C[C@@H](C(=O)O1)O |
| InChI | 1S/C6H8O5/c1-10-6(9)4-2-3(7)5(8)11-4/h3-4,7H,2H2,1H3/t3-,4-/m0/s1 |
| InChIKey | UNSIDMOABLNHFX-IMJSIDKUSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.725°C at 760 mmHg (Cal.) |
| Flash point | 129.671°C (Cal.) |
| Refractive index | 1.502 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2S,4S)-4-Hydroxy-5-Oxotetrahydro-2-Furancarboxylate |