|
CAS#: 123914-44-3 Product: 3,22-Dihydroxy-11-Oxo-delta(12)-Oleanene-27-alpha-Methoxycarbonyl-29-Oic Acid No suppilers available for the product. |
| Name | 3,22-Dihydroxy-11-Oxo-delta(12)-Oleanene-27-alpha-Methoxycarbonyl-29-Oic Acid |
|---|---|
| Synonyms | Olean-12-Ene-27,29-Dioic Acid, 3,22-Dihydroxy-11-Oxo-, Gamma-Lactone, Methyl Ester, (3Beta,20Alpha,22Alpha)- |
| Molecular Structure | ![]() |
| Molecular Formula | C31H44O6 |
| Molecular Weight | 512.69 |
| CAS Registry Number | 123914-44-3 |
| SMILES | [C@H]1(O)CC[C@]2([C@H](C1(C)C)CC[C@@]3([C@@H]2C(C=C4[C@]3(CC[C@@]5([C@H]4C[C@@]6(C[C@H]5OC6=O)C)C)C(OC)=O)=O)C)C |
| InChI | 1S/C31H44O6/c1-26(2)20-8-11-30(6)23(29(20,5)10-9-21(26)33)19(32)14-17-18-15-27(3)16-22(37-24(27)34)28(18,4)12-13-31(17,30)25(35)36-7/h14,18,20-23,33H,8-13,15-16H2,1-7H3/t18-,20-,21-,22+,23+,27+,28+,29-,30+,31+/m0/s1 |
| InChIKey | MKDSBDQLSLPNOQ-YDJDNKAXSA-N |
| Density | 1.218g/cm3 (Cal.) |
|---|---|
| Boiling point | 626.36°C at 760 mmHg (Cal.) |
| Flash point | 198.013°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,22-Dihydroxy-11-Oxo-delta(12)-Oleanene-27-alpha-Methoxycarbonyl-29-Oic Acid |