| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Sodium diiodomethanesulfonate |
|---|---|
| Synonyms | Diiodomethanesulfonic Acid, Disodium Salt; Dimethiodal; Dimethiodal Sodium |
| Molecular Structure | ![]() |
| Molecular Formula | CHI2NaO3S |
| Molecular Weight | 369.88 |
| CAS Registry Number | 124-88-9 |
| SMILES | O=[S](C(I)I)(=O)[O-].[Na+] |
| InChI | 1S/CH2I2O3S.Na/c2-1(3)7(4,5)6;/h1H,(H,4,5,6);/q;+1/p-1 |
| InChIKey | BPILDHPJSYVNAF-UHFFFAOYSA-M |
| (1) | Rashi Halder, Kangkan Halder, Priyanka Sharma, Gaurav Garg, Shantanu Sengupta and Shantanu Chowdhury. Guanine quadruplex DNA structure restricts methylation of CpG dinucleotides genome-wide, Mol. Biosyst., 2010, 6, 2439. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Sodium diiodomethanesulfonate |