|
CAS#: 124069-05-2 Product: 2,3,6-Tri(Phenyl)Piperidin-4-One No suppilers available for the product. |
| Name | 2,3,6-Tri(Phenyl)Piperidin-4-One |
|---|---|
| Synonyms | 2,3,6-Tri(Phenyl)-4-Piperidinone; 2,3,6-Tri(Phenyl)-4-Piperidone; 4-Piperidinone, 2,3,6-Triphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 |
| CAS Registry Number | 124069-05-2 |
| SMILES | C1=CC=CC=C1C2NC(C(C(C2)=O)C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C23H21NO/c25-21-16-20(17-10-4-1-5-11-17)24-23(19-14-8-3-9-15-19)22(21)18-12-6-2-7-13-18/h1-15,20,22-24H,16H2 |
| InChIKey | VPPWKQCLUBXUKR-UHFFFAOYSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.678°C at 760 mmHg (Cal.) |
| Flash point | 163.262°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,6-Tri(Phenyl)Piperidin-4-One |