Online Database of Chemicals from Around the World
|
CAS#: 124076-66-0 Product: 1,2,3-Trichloro-4-(2,3,6-Trichlorophenoxy)Benzene No suppilers available for the product. |
| Name | 1,2,3-Trichloro-4-(2,3,6-Trichlorophenoxy)Benzene |
|---|---|
| Synonyms | 2,2',3,3',4,6'-Hexachlorodiphenyl Ether; Benzene, 1,2,3-Trichloro-4-(2,3,6-Trichlorophenoxy)-; Cde3 |
| Molecular Structure |  |
| Molecular Formula | C12H4Cl6O |
| Molecular Weight | 376.88 |
| CAS Registry Number | 124076-66-0 |
| SMILES | C1=CC(=C(Cl)C(=C1Cl)Cl)OC2=C(C(=CC=C2Cl)Cl)Cl |
| InChI | 1S/C12H4Cl6O/c13-5-3-4-8(11(18)9(5)16)19-12-7(15)2-1-6(14)10(12)17/h1-4H |
| InChIKey | YDVYLSIVXYLBBX-UHFFFAOYSA-N |
| Density | 1.626g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.781°C at 760 mmHg (Cal.) |
| Flash point | 132.091°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3-Trichloro-4-(2,3,6-Trichlorophenoxy)Benzene |