|
CAS#: 1242-69-9 Product: Decitropine No suppilers available for the product. |
| Name | Decitropine |
|---|---|
| Synonyms | 3Alpha-(5H-Dibenzo(A,D)Cyclohepten-5-Yloxy)Tropane; Decitropin; Decitropina |
| Molecular Structure | ![]() |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 |
| CAS Registry Number | 1242-69-9 |
| SMILES | C1=CC=CC2=C1C(C3=C(C=C2)C=CC=C3)OC4CC5N(C)C(C4)CC5 |
| InChI | 1S/C23H25NO/c1-24-18-12-13-19(24)15-20(14-18)25-23-21-8-4-2-6-16(21)10-11-17-7-3-5-9-22(17)23/h2-11,18-20,23H,12-15H2,1H3 |
| InChIKey | GQAWDMWLORTZKF-UHFFFAOYSA-N |
| Density | 1.18g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.133°C at 760 mmHg (Cal.) |
| Flash point | 138.39°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Decitropine |