|
CAS#: 124236-24-4 Product: 8-Chloro-3-(3,4-Dihydroxyphenyl)-5,7-Dihydroxychromen-4-One No suppilers available for the product. |
| Name | 8-Chloro-3-(3,4-Dihydroxyphenyl)-5,7-Dihydroxychromen-4-One |
|---|---|
| Synonyms | 8-Chloro-3-(3,4-Dihydroxyphenyl)-5,7-Dihydroxy-Chromen-4-One; 8-Chloro-3-(3,4-Dihydroxyphenyl)-5,7-Dihydroxy-4-Chromenone; 8-Chloro-3-(3,4-Dihydroxyphenyl)-5,7-Dihydroxy-Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H9ClO6 |
| Molecular Weight | 320.69 |
| CAS Registry Number | 124236-24-4 |
| SMILES | C3=C(O)C1=C(OC=C(C1=O)C2=CC(=C(O)C=C2)O)C(=C3O)Cl |
| InChI | 1S/C15H9ClO6/c16-13-11(20)4-10(19)12-14(21)7(5-22-15(12)13)6-1-2-8(17)9(18)3-6/h1-5,17-20H |
| InChIKey | PXEKXMKLPKBART-UHFFFAOYSA-N |
| Density | 1.734g/cm3 (Cal.) |
|---|---|
| Boiling point | 625.672°C at 760 mmHg (Cal.) |
| Flash point | 332.194°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Chloro-3-(3,4-Dihydroxyphenyl)-5,7-Dihydroxychromen-4-One |