|
CAS#: 124388-77-8 Product: 2,3,4,6,7-Pentabromodibenzofuran No suppilers available for the product. |
| Name | 2,3,4,6,7-Pentabromodibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 2,3,4,6,7-Pentabromo- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H3Br5O |
| Molecular Weight | 562.68 |
| CAS Registry Number | 124388-77-8 |
| SMILES | C1=C2C(=C(C(=C1Br)Br)Br)OC3=C(C(=CC=C23)Br)Br |
| InChI | 1S/C12H3Br5O/c13-6-2-1-4-5-3-7(14)8(15)10(17)12(5)18-11(4)9(6)16/h1-3H |
| InChIKey | DOMLPUMLHHUETA-UHFFFAOYSA-N |
| Density | 2.542g/cm3 (Cal.) |
|---|---|
| Boiling point | 537.53°C at 760 mmHg (Cal.) |
| Flash point | 278.888°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,6,7-Pentabromodibenzofuran |