|
CAS#: 124501-87-7 Product: [(1R,2S,3R,5S,6R)-2,5-Dihydroxy-3,6-Diphosphonooxycyclohexyl] Dihydrogen Phosphate No suppilers available for the product. |
| Name | [(1R,2S,3R,5S,6R)-2,5-Dihydroxy-3,6-Diphosphonooxycyclohexyl] Dihydrogen Phosphate |
|---|---|
| Synonyms | [(1R,2S,3R,5S,6R)-2,5-Dihydroxy-3,6-Diphosphonooxy-Cyclohexyl] Dihydrogen Phosphate; 6-Deoxy-Ins(1,4,5)P3; 6-Deoxyinositol 1,4,5-Triphosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H15O14P3 |
| Molecular Weight | 404.10 |
| CAS Registry Number | 124501-87-7 |
| SMILES | [C@@H]1(C[C@H]([C@H](O)[C@@H](O[P](=O)(O)O)[C@@H]1O[P](=O)(O)O)O[P](=O)(O)O)O |
| InChI | 1S/C6H15O14P3/c7-2-1-3(18-21(9,10)11)4(8)6(20-23(15,16)17)5(2)19-22(12,13)14/h2-8H,1H2,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)/t2-,3+,4-,5+,6+/m0/s1 |
| InChIKey | GHYKQXTYUPPQMF-DSOBHZJASA-N |
| Density | 2.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 853.523°C at 760 mmHg (Cal.) |
| Flash point | 469.994°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(1R,2S,3R,5S,6R)-2,5-Dihydroxy-3,6-Diphosphonooxycyclohexyl] Dihydrogen Phosphate |