|
CAS#: 1247-12-7 Product: Bis(Pentafluorophenyl)(Divinyl)Stannane No suppilers available for the product. |
| Name | Bis(Pentafluorophenyl)(Divinyl)Stannane |
|---|---|
| Synonyms | Bis(2,3,4,5,6-pentafluorophenyl)(divinyl)stannane # |
| Molecular Structure | ![]() |
| Molecular Formula | C16H6F10Sn |
| Molecular Weight | 506.91 |
| CAS Registry Number | 1247-12-7 |
| SMILES | Fc1c(c(F)c(F)c(F)c1F)[Sn](c2c(F)c(F)c(F)c(F)c2F)(\C=C)\C=C |
| InChI | 1S/2C6F5.2C2H3.Sn/c2*7-2-1-3(8)5(10)6(11)4(2)9;2*1-2;/h;;2*1H,2H2; |
| InChIKey | AJICOJCRYZXBEL-UHFFFAOYSA-N |
| Boiling point | 326.001°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 150.96°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Pentafluorophenyl)(Divinyl)Stannane |