|
CAS#: 125136-34-7 Product: (2R)-2-Amino-3-(7H-Purin-6-Ylsulfanyl)Propanoic Acid No suppilers available for the product. |
| Name | (2R)-2-Amino-3-(7H-Purin-6-Ylsulfanyl)Propanoic Acid |
|---|---|
| Synonyms | (2R)-2-Amino-3-(7H-Purin-6-Ylthio)Propanoic Acid; (2R)-2-Amino-3-(7H-Purin-6-Ylthio)Propionic Acid; L-Cysteine, S-1H-Purin-6-Yl- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9N5O2S |
| Molecular Weight | 239.25 |
| CAS Registry Number | 125136-34-7 |
| SMILES | [C@H](N)(CSC1=NC=NC2=C1[NH]C=N2)C(O)=O |
| InChI | 1S/C8H9N5O2S/c9-4(8(14)15)1-16-7-5-6(11-2-10-5)12-3-13-7/h2-4H,1,9H2,(H,14,15)(H,10,11,12,13)/t4-/m0/s1 |
| InChIKey | XGNASSAYQHESTL-BYPYZUCNSA-N |
| Density | 1.654g/cm3 (Cal.) |
|---|---|
| Boiling point | 622.144°C at 760 mmHg (Cal.) |
| Flash point | 330.061°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-2-Amino-3-(7H-Purin-6-Ylsulfanyl)Propanoic Acid |