|
CAS#: 125257-74-1 Product: 3-Hydroxy-4,4-Dimethyl-3-[(2E)-4-Oxo-2-Penten-2-Yl]Cycloheptanone No suppilers available for the product. |
| Name | 3-Hydroxy-4,4-Dimethyl-3-[(2E)-4-Oxo-2-Penten-2-Yl]Cycloheptanone |
|---|---|
| Synonyms | 3-Hydroxy |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.32 |
| CAS Registry Number | 125257-74-1 |
| SMILES | O=C(\C=C(\C1(O)CC(=O)CCCC1(C)C)C)C |
| InChI | 1S/C14H22O3/c1-10(8-11(2)15)14(17)9-12(16)6-5-7-13(14,3)4/h8,17H,5-7,9H2,1-4H3/b10-8+ |
| InChIKey | BUHWWICPKIKVBG-CSKARUKUSA-N |
| Density | 1.042g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.298°C at 760 mmHg (Cal.) |
| Flash point | 196.16°C (Cal.) |
| Refractive index | 1.491 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxy-4,4-Dimethyl-3-[(2E)-4-Oxo-2-Penten-2-Yl]Cycloheptanone |