|
CAS#: 125332-48-1 Product: Coetsoidin A No suppilers available for the product. |
| Name | Coetsoidin A |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 |
| CAS Registry Number | 125332-48-1 |
| SMILES | [C@H]13C45C(=C(O)C(=O)C12[C@H](OC(=O)C)C(C(C2)CC3)=C)C([C@@H](OC4)CC5=O)(C)C |
| InChI | 1S/C22H26O6/c1-10-12-5-6-13-21(8-12,19(10)28-11(2)23)18(26)16(25)17-20(3,4)15-7-14(24)22(13,17)9-27-15/h12-13,15,19,25H,1,5-9H2,2-4H3/t12?,13-,15+,19-,21?,22?/m1/s1 |
| InChIKey | UOYUDLWZKQVTAO-ZSVJTNQJSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 571.985°C at 760 mmHg (Cal.) |
| Flash point | 200.581°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Coetsoidin A |