|
CAS#: 125421-24-1 Product: 1-[(2-Aminophenyl)Carbamothioyl]Pyrrolidine-2-Carboxylic Acid No suppilers available for the product. |
| Name | 1-[(2-Aminophenyl)Carbamothioyl]Pyrrolidine-2-Carboxylic Acid |
|---|---|
| Synonyms | 1-[[(2-Aminophenyl)Amino]-Thioxomethyl]-2-Pyrrolidinecarboxylic Acid; 1-[(2-Aminophenyl)Thiocarbamoyl]Proline; 2-Amino-Ptc-Pro |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.33 |
| CAS Registry Number | 125421-24-1 |
| SMILES | C2=C(NC(=S)N1C(CCC1)C(=O)O)C(=CC=C2)N |
| InChI | 1S/C12H15N3O2S/c13-8-4-1-2-5-9(8)14-12(18)15-7-3-6-10(15)11(16)17/h1-2,4-5,10H,3,6-7,13H2,(H,14,18)(H,16,17) |
| InChIKey | UQLKULVDTBNSTR-UHFFFAOYSA-N |
| Density | 1.468g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.922°C at 760 mmHg (Cal.) |
| Flash point | 237.396°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(2-Aminophenyl)Carbamothioyl]Pyrrolidine-2-Carboxylic Acid |