Online Database of Chemicals from Around the World
| Name | 6-Cyclohexyl-1,3,8-Trichlorodibenzofuran |
|---|---|
| Synonyms | 1,3,8-Trichloro-6-Cyclohexyl-Dibenzofuran; 1,3,8-Trichloro-6-(Cyclohexyl)Dibenzofuran; 6-Cyclohexyl-1,3,8-Tricdf |
| Molecular Structure |  |
| Molecular Formula | C18H15Cl3O |
| Molecular Weight | 353.67 |
| CAS Registry Number | 125652-15-5 |
| SMILES | C3=C(C=C2OC1=C(C=C(C=C1C2=C3Cl)Cl)C4CCCCC4)Cl |
| InChI | 1S/C18H15Cl3O/c19-11-6-13(10-4-2-1-3-5-10)18-14(7-11)17-15(21)8-12(20)9-16(17)22-18/h6-10H,1-5H2 |
| InChIKey | FGPQOHFXRNGRPW-UHFFFAOYSA-N |
| Density | 1.373g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.751°C at 760 mmHg (Cal.) |
| Flash point | 241.526°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Cyclohexyl-1,3,8-Trichlorodibenzofuran |
