|
CAS#: 125974-72-3 Product: 11-((3-(Dimethylamino)Propyl)Amino)-8-Methyl-7H-Benzo(E)Pyrido(4,3-b)Indol-3-Ol No suppilers available for the product. |
| Name | 11-((3-(Dimethylamino)Propyl)Amino)-8-Methyl-7H-Benzo(E)Pyrido(4,3-b)Indol-3-Ol |
|---|---|
| Synonyms | 7H-Benzo(E)Pyrido(4,3-B)Indol-3-Ol, 11-((3-(Dimethylamino)Propyl)Amino)-8-Methyl-; Intoplicine [Inn]; Nci60_015286 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 |
| CAS Registry Number | 125974-72-3 |
| SMILES | C4=C3C1=C([NH]C2=C1C(=NC=C2C)NCCCN(C)C)C=CC3=CC(=C4)O |
| InChI | 1S/C21H24N4O/c1-13-12-23-21(22-9-4-10-25(2)3)19-18-16-7-6-15(26)11-14(16)5-8-17(18)24-20(13)19/h5-8,11-12,24,26H,4,9-10H2,1-3H3,(H,22,23) |
| InChIKey | QROONAIPJKQFMC-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 635.528°C at 760 mmHg (Cal.) |
| Flash point | 338.155°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-((3-(Dimethylamino)Propyl)Amino)-8-Methyl-7H-Benzo(E)Pyrido(4,3-b)Indol-3-Ol |