|
CAS#: 126114-66-7 Product: 1-Methyl-1-Phenyl-1,2,3,4-Tetrahydroisoquinoline No suppilers available for the product. |
| Name | 1-Methyl-1-Phenyl-1,2,3,4-Tetrahydroisoquinoline |
|---|---|
| Synonyms | 1-Methyl-1-Phenyl-1,2,3,4-Tetrahydroisoquinoline; Fr 115427; Fr-115427 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18ClN |
| Molecular Weight | 259.78 |
| CAS Registry Number | 126114-66-7 |
| SMILES | [H+].C1=CC=CC2=C1C(NCC2)(C3=CC=CC=C3)C.[Cl-] |
| InChI | 1S/C16H17N.ClH/c1-16(14-8-3-2-4-9-14)15-10-6-5-7-13(15)11-12-17-16;/h2-10,17H,11-12H2,1H3;1H |
| InChIKey | LUSUZDOXGNAITA-UHFFFAOYSA-N |
| Boiling point | 335.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 162.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-1-Phenyl-1,2,3,4-Tetrahydroisoquinoline |