|
CAS#: 12626-73-2 Product: Indigo Blue (Powder) No suppilers available for the product. |
| Name | Indigo Blue (Powder) |
|---|---|
| Synonyms | (2E)-2-(3-Oxoindolin-2-Ylidene)Indolin-3-One; (2E)-2-(3-Oxo-2-Indolinylidene)-3-Indolinone; (2E)-2-(3-Ketoindolin-2-Ylidene)Pseudoindoxyl |
| Molecular Structure | ![]() |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.27 |
| CAS Registry Number | 12626-73-2 |
| SMILES | C1=CC=CC4=C1C(\C(=C2\C(C3=C(N2)C=CC=C3)=O)N4)=O |
| InChI | 1S/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14/h1-8,17-18H/b14-13+ |
| InChIKey | COHYTHOBJLSHDF-BUHFOSPRSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.4±45.0°C at 760 mmHg (Cal.) |
| Flash point | 158.2±28.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Indigo Blue (Powder) |