|
CAS#: 126296-30-8 Product: (2,3,5,6-Tetrafluorophenyl) 5-Iodo-3,3-Dimethylpent-4-Enoate No suppilers available for the product. |
| Name | (2,3,5,6-Tetrafluorophenyl) 5-Iodo-3,3-Dimethylpent-4-Enoate |
|---|---|
| Synonyms | (2,3,5,6-Tetrafluorophenyl) (E)-5-Iodo-3,3-Dimethylpent-4-Enoate; (2,3,5,6-Tetrafluorophenyl) 5-Iodo-3,3-Dimethyl-Pent-4-Enoate; (2,3,5,6-Tetrafluorophenyl) (E)-5-Iodo-3,3-Dimethyl-Pent-4-Enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11F4IO2 |
| Molecular Weight | 402.13 |
| CAS Registry Number | 126296-30-8 |
| SMILES | C1=C(C(=C(C(=C1F)F)OC(CC(\C=C\I)(C)C)=O)F)F |
| InChI | 1S/C13H11F4IO2/c1-13(2,3-4-18)6-9(19)20-12-10(16)7(14)5-8(15)11(12)17/h3-5H,6H2,1-2H3/b4-3+ |
| InChIKey | DTBLTGULTCNTLR-ONEGZZNKSA-N |
| Density | 1.683g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.072°C at 760 mmHg (Cal.) |
| Flash point | 171.566°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,3,5,6-Tetrafluorophenyl) 5-Iodo-3,3-Dimethylpent-4-Enoate |