|
CAS#: 126582-77-2 Product: (Z)-3-Chloro-2-Phosphonooxyprop-2-Enoic Acid No suppilers available for the product. |
| Name | (Z)-3-Chloro-2-Phosphonooxyprop-2-Enoic Acid |
|---|---|
| Synonyms | (Z)-3-Chloro-2-Phosphonooxy-Prop-2-Enoic Acid; (Z)-3-Chloro-2-Phosphonooxy-Acrylic Acid; 2-Propenoic Acid, 3-Chloro-2-(Phosphonooxy)-, (Z)- |
| Molecular Structure | ![]() |
| Molecular Formula | C3H4ClO6P |
| Molecular Weight | 202.49 |
| CAS Registry Number | 126582-77-2 |
| SMILES | O=[P](OC(/C(=O)O)=C\Cl)(O)O |
| InChI | 1S/C3H4ClO6P/c4-1-2(3(5)6)10-11(7,8)9/h1H,(H,5,6)(H2,7,8,9)/b2-1- |
| InChIKey | UAMWGCMNOPAITA-UPHRSURJSA-N |
| Density | 1.966g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.142°C at 760 mmHg (Cal.) |
| Flash point | 214.547°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-3-Chloro-2-Phosphonooxyprop-2-Enoic Acid |