| Name | (1R,2R,3R,4S,5R,6S)-2-(Hydroxymethyl)-7-Oxabicyclo[4.1.0]Heptane-3,4,5-Triol |
|---|---|
| Synonyms | (1R,2R,3R,4S,5R,6S)-2-Methylol-7-Oxabicyclo[4.1.0]Heptane-3,4,5-Triol; 5-Hydroxymethyl-7-Oxabicyclo(4,1,0)Heptane-2,3,4-Triol; Cyclophellitol |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 |
| CAS Registry Number | 126661-83-4 |
| SMILES | [C@H]12O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO |
| InChI | 1S/C7H12O5/c8-1-2-3(9)4(10)5(11)7-6(2)12-7/h2-11H,1H2/t2-,3-,4+,5-,6-,7+/m1/s1 |
| InChIKey | YQLWKYQDOQEWRD-GEGSFZHJSA-N |
| Density | 1.665g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.352°C at 760 mmHg (Cal.) |
| Flash point | 191.088°C (Cal.) |
| (1) | Witte et al.. Ultrasensitive in situ visualization of active glucocerebrosidase molecules, Nature Chemical Biology, 2010 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1R,2R,3R,4S,5R,6S)-2-(Hydroxymethyl)-7-Oxabicyclo[4.1.0]Heptane-3,4,5-Triol |