|
CAS#: 126828-40-8 Product: 1,4-Diethoxy-5-Ethyl-6-Methylpyridazino[4,5-b]Carbazole No suppilers available for the product. |
| Name | 1,4-Diethoxy-5-Ethyl-6-Methylpyridazino[4,5-b]Carbazole |
|---|---|
| Synonyms | 1,4-Diethoxy-5-Ethyl-6-Methyl-Pyridazino[4,5-B]Carbazole; 1,4-Diethoxy-5-Ethyl-6-Methyl-6H-Pyridazino(4,5-B)Carbazole; 6H-Pyridazino(4,5-B)Carbazole, 1,4-Diethoxy-5-Ethyl-6-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 |
| CAS Registry Number | 126828-40-8 |
| SMILES | C1=C4C(=C(C2=C1C3=C([N]2C)C=CC=C3)CC)C(=NN=C4OCC)OCC |
| InChI | 1S/C21H23N3O2/c1-5-13-18-16(20(25-6-2)22-23-21(18)26-7-3)12-15-14-10-8-9-11-17(14)24(4)19(13)15/h8-12H,5-7H2,1-4H3 |
| InChIKey | IPRNHDAQKJPNFI-UHFFFAOYSA-N |
| Density | 1.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 541.765°C at 760 mmHg (Cal.) |
| Flash point | 281.45°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Diethoxy-5-Ethyl-6-Methylpyridazino[4,5-b]Carbazole |