Online Database of Chemicals from Around the World
| Quality Phytochemicals LLC | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (908) 510-9277 | |||
 |
sales@qualityphytochemicalsllc.com | |||
| Chemical manufacturer | ||||
| Name | 1,2,15,16-Tetrahydrotanshiquinone |
|---|---|
| Synonyms | 1,6-Dimethyl-1,2,8,9-Tetrahydronaphtho[8,7-G]Benzofuran-10,11-Dione; 1,6-Dimethyl-1,2,8,9-Tetrahydronaphtho[8,7-G]Benzofuran-10,11-Quinone; Phenantrho(1,2-B)Furan-10,11-Dione, 1,2,8,9-Tetrahydro-1,6-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 |
| CAS Registry Number | 126979-84-8 |
| SMILES | C1=CC4=C(C2=C1C3=C(C(C2=O)=O)C(C)CO3)CCC=C4C |
| InChI | 1S/C18H16O3/c1-9-4-3-5-12-11(9)6-7-13-15(12)17(20)16(19)14-10(2)8-21-18(13)14/h4,6-7,10H,3,5,8H2,1-2H3 |
| InChIKey | AZIUYJPOBCMPON-UHFFFAOYSA-N |
| Density | 1.298g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.029°C at 760 mmHg (Cal.) |
| Flash point | 210.227°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,15,16-Tetrahydrotanshiquinone |