|
CAS#: 12712-28-6 Product: 2,2-Bis(Chloromethyl)-1,3-Propanediol Sulfate No suppilers available for the product. |
| Name | 2,2-Bis(Chloromethyl)-1,3-Propanediol Sulfate |
|---|---|
| Synonyms | 1,3-Propanediol, 2,2-Bis(Chloromethyl)-, Sulfate; Philips 2605 |
| Molecular Structure | ![]() |
| Molecular Formula | C5H12Cl2O6S |
| Molecular Weight | 271.11 |
| CAS Registry Number | 12712-28-6 |
| EINECS | 235-780-3 |
| SMILES | C(Cl)C(CCl)(CO)CO.O=[S](=O)(O)O |
| InChI | 1S/C5H10Cl2O2.H2O4S/c6-1-5(2-7,3-8)4-9;1-5(2,3)4/h8-9H,1-4H2;(H2,1,2,3,4) |
| InChIKey | HROJKPIFOUEBIR-UHFFFAOYSA-N |
| Boiling point | 334.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 156.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Bis(Chloromethyl)-1,3-Propanediol Sulfate |