|
CAS#: 127231-62-3 Product: Phosphono [(2E,7R)-3,7,11-Trimethyldodeca-2,10-Dienyl] Hydrogen Phosphate No suppilers available for the product. |
| Name | Phosphono [(2E,7R)-3,7,11-Trimethyldodeca-2,10-Dienyl] Hydrogen Phosphate |
|---|---|
| Synonyms | 6,7-Dihydrofarnesyl Pyrophosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H30O7P2 |
| Molecular Weight | 384.35 |
| CAS Registry Number | 127231-62-3 |
| SMILES | [C@@H](CCC/C(=C/CO[P](O[P](=O)(O)O)(=O)O)C)(CCC=C(C)C)C |
| InChI | 1S/C15H30O7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h7,11,14H,5-6,8-10,12H2,1-4H3,(H,19,20)(H2,16,17,18)/b15-11+/t14-/m0/s1 |
| InChIKey | DJYAAXRYOPSPFW-AYYGCFCKSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.823°C at 760 mmHg (Cal.) |
| Flash point | 264.551°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphono [(2E,7R)-3,7,11-Trimethyldodeca-2,10-Dienyl] Hydrogen Phosphate |