|
CAS#: 127311-90-4 Product: 5-endo-Carboxyendothall anhydride No suppilers available for the product. |
| Name | 5-endo-Carboxyendothall anhydride |
|---|---|
| Synonyms | 5-Endo-Carboxyendothall Anhydride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8O6 |
| Molecular Weight | 212.16 |
| CAS Registry Number | 127311-90-4 |
| SMILES | [C@@H]12C(OC([C@@H]1[C@H]3C[C@H]([C@@H]2O3)C(=O)O)=O)=O |
| InChI | 1S/C9H8O6/c10-7(11)2-1-3-4-5(6(2)14-3)9(13)15-8(4)12/h2-6H,1H2,(H,10,11)/t2-,3-,4-,5-,6+/m1/s1 |
| InChIKey | GQOKHYKFPZJCCC-UKFBFLRUSA-N |
| Density | 1.673g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.767°C at 760 mmHg (Cal.) |
| Flash point | 219.726°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-endo-Carboxyendothall anhydride |