|
CAS#: 127474-91-3 Product: Bis(2-Ethylhexyl) 2,6-Naphthalenedicarboxylate No suppilers available for the product. |
| Name | Bis(2-Ethylhexyl) 2,6-Naphthalenedicarboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.61 |
| CAS Registry Number | 127474-91-3 |
| SMILES | O=C(OCC(CC)CCCC)c1ccc2c(c1)ccc(C(=O)OCC(CC)CCCC)c2 |
| InChI | 1S/C28H40O4/c1-5-9-11-21(7-3)19-31-27(29)25-15-13-24-18-26(16-14-23(24)17-25)28(30)32-20-22(8-4)12-10-6-2/h13-18,21-22H,5-12,19-20H2,1-4H3 |
| InChIKey | UFVWHIGSVGIZRQ-UHFFFAOYSA-N |
| Density | 1.022g/cm3 (Cal.) |
|---|---|
| Boiling point | 537.956°C at 760 mmHg (Cal.) |
| Flash point | 260.326°C (Cal.) |
| Refractive index | 1.526 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-Ethylhexyl) 2,6-Naphthalenedicarboxylate |