|
CAS#: 127531-18-4 Product: 4-[[Dithiocarboxy-[(2S,3R,4R,5R)-2,3,4,5,6-Pentahydroxyhexyl]Amino]Methyl]Benzoic Acid No suppilers available for the product. |
| Name | 4-[[Dithiocarboxy-[(2S,3R,4R,5R)-2,3,4,5,6-Pentahydroxyhexyl]Amino]Methyl]Benzoic Acid |
|---|---|
| Synonyms | N-4-Carboxybenzylglucamine Dithiocarbamate; N-Cbgd; N-P-Carboxybenzyl-D-Glucamine Dithiocarbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H21NO7S2 |
| Molecular Weight | 391.45 |
| CAS Registry Number | 127531-18-4 |
| SMILES | [C@@H](CN(C(=S)S)CC1=CC=C(C=C1)C(=O)O)(O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | 1S/C15H21NO7S2/c17-7-11(19)13(21)12(20)10(18)6-16(15(24)25)5-8-1-3-9(4-2-8)14(22)23/h1-4,10-13,17-21H,5-7H2,(H,22,23)(H,24,25)/t10-,11+,12+,13+/m0/s1 |
| InChIKey | FVBVEHVQVWFUKG-UMSGYPCISA-N |
| Density | 1.571g/cm3 (Cal.) |
|---|---|
| Boiling point | 729.191°C at 760 mmHg (Cal.) |
| Flash point | 394.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[[Dithiocarboxy-[(2S,3R,4R,5R)-2,3,4,5,6-Pentahydroxyhexyl]Amino]Methyl]Benzoic Acid |