|
CAS#: 127685-99-8 Product: 5,6-Dihydroxy-7-fluorotryptamine creatinine No suppilers available for the product. |
| Name | 5,6-Dihydroxy-7-fluorotryptamine creatinine |
|---|---|
| Synonyms | 5,6-D-7-Ftc; 5,6-Dihydroxy-7-Fluorotryptamine Creatinine; 2-Amino-1,5-Dihydro-1-Methyl-4H-Imidazol-4-One Compd. With 3-(2-Aminoethyl)-7-Fluoro-1H-Indole-5,6-Diol Sulfate (Salt) (1:1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20FN5O7S |
| Molecular Weight | 421.40 |
| CAS Registry Number | 127685-99-8 |
| SMILES | O=[S](=O)(O)O.C1=C(O)C(=C(F)C2=C1C(=C[NH]2)CCN)O.CN3C(=NC(=O)C3)N |
| InChI | 1S/C10H11FN2O2.C4H7N3O.H2O4S/c11-8-9-6(3-7(14)10(8)15)5(1-2-12)4-13-9;1-7-2-3(8)6-4(7)5;1-5(2,3)4/h3-4,13-15H,1-2,12H2;2H2,1H3,(H2,5,6,8);(H2,1,2,3,4) |
| InChIKey | QWLPHRORYKWBHE-UHFFFAOYSA-N |
| Boiling point | 459.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 231.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dihydroxy-7-fluorotryptamine creatinine |